|
|
| | Cy7 Carboxylic acids Basic information |
| Product Name: | Cy7 Carboxylic acids | | Synonyms: | Cy7 Carboxylic acids;Cyclohexane Cyanine7 carboxylic acid;CY7-C00H;Cyanine7-Acid;2-(2-(3-(2-(1-(5-Carboxypentyl)-3,3-dimethylindolin-2-ylidene)ethylidene)cyclohex-1-en-1-yl)vinyl)-1,3,3-trimethyl-3H-indol-1-ium chloride;Cyanine7 carboxylic acid (Cyclohexene) | | CAS: | 1628790-40-8 | | MF: | C37H45ClN2O2 | | MW: | 585.23 | | EINECS: | | | Product Categories: | | | Mol File: | 1628790-40-8.mol |  |
| | Cy7 Carboxylic acids Chemical Properties |
| solubility | Soluble in DMSO, DMF, DCM, low solubility in water | | Appearance | green powder | | InChIKey | FOVQXMYLXAXGJR-UHFFFAOYSA-N | | SMILES | C(N1C(C(C)(C)C2=CC=CC=C12)=CC=C1CCCC(C=CC2=[N+](C3=CC=CC=C3C2(C)C)C)=C1)CCCCC(=O)O.[Cl-] |
| | Cy7 Carboxylic acids Usage And Synthesis |
| Description | Cy7 carboxylic acid is a free non-activated NIR (near-infraed fluorescent) dye. It is a non-sulfonated reagent with good solubility in organic solvents and limited aquous solubility. | | Uses | Cyanine7 carboxylic acid chloride belongs to the cyanine dye series and is a common fluorescent marker for biomolecules that can interact with biomolecules. Cyanine dyes may also bind to double-helical DNA through intercalation and exhibit enhanced fluorescence upon binding. | | References | [1] Armitage B A. Cyanine dye–DNA interactions: intercalation, groove binding, and aggregation[J]. DNA Binders and Related Subjects: -/-, 2005: 55-76. | | Abs/Em Maxima | 750/773 nm | | Extinction Coefficient | 199000 | | CF260 | 0.022 | | CF280 | 0.029 |
| | Cy7 Carboxylic acids Preparation Products And Raw materials |
|