| Company Name: |
Xi'an Confluore Biological Technology Co., Ltd.
|
| Tel: |
+86-156-80926068 +86-15680926068 |
| Email: |
1924344760@qq.com |
| Products Intro: |
Product Name:Cyanine5.5 carboxylic acid
CAS:1449612-07-0
Purity:98% HPLC Package:10MG;25MG;50MG;100MG;1G;5G
|
Cy5.5 carboxylic acid manufacturers
|
| | Cy5.5 carboxylic acid Basic information |
| Product Name: | Cy5.5 carboxylic acid | | Synonyms: | Cy5.5 carboxylic acid;6-(1,1-Dimethyl-2-(5-(1,1,3-trimethyl-1H-benzo[e]indol-3-ium-2-yl)penta-2,4-dien-1-ylidene)-1,2-dihydro-3H-benzo[e]indol-3-yl)hexanoate | | CAS: | 1449612-07-0 | | MF: | C40H42N2O2 | | MW: | 582.79 | | EINECS: | | | Product Categories: | | | Mol File: | 1449612-07-0.mol |  |
| | Cy5.5 carboxylic acid Chemical Properties |
| solubility | Soluble in DMSO, DMF, DCM | | form | Solid | | color | Brown to reddish brown | | Appearance | Dark blue solid | | ε(extinction coefficient) | 198000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.20 | | ex/em | 680/698 nm (PBS buffer) | | InChIKey | MQFHWNVLHOOSOL-UHFFFAOYSA-N | | SMILES | CC1(C(N(CCCCCC(=O)[O-])C2C=CC3=CC=CC=C3C1=2)=CC=CC=CC1=[N+](C2C=CC3=CC=CC=C3C=2C1(C)C)C)C |
| | Cy5.5 carboxylic acid Usage And Synthesis |
| Description | Cy5.5 carboxylic acid is a free non-activated dye and can be used as a non-reactive fluorophore for experiment controls and instrument calibration. It is a non-sulfonated reagent with good solubility in organic solvents and limited aquous solubility. | | Chemical Properties | Appearance: Dark blue solid
ex/em: 680/698 nm (PBS buffer)
Extinction coefficient (ε): 198000 Lmol1cm1
Quantum yield (Φ): 0.20 | | Uses | CY5.5-COOH (Cyanine 5.5 carboxylic acid) is a fluorescent dye, is commonly used in bioimaging. CY5.5-COOH shows narrow absorption spectrum, and high sensitivity and stability[1]. | | References | [1] Sijoon Lee, et al. Toxicity and Biodistribution of Fragmented Polypropylene Microplastics in ICR Mice. Int J Mol Sci. 2023 May 9;24(10):8463. DOI:10.3390/ijms24108463 |
| | Cy5.5 carboxylic acid Preparation Products And Raw materials |
|