| Company Name: |
Guangzhou Weihua Biotechnology Co., Ltd Gold
|
| Tel: |
020-37239396 18922496242 |
| Email: |
weihuasw@foxmail.com |
| Products Intro: |
Product Name:CY7-COOH
CAS:1144107-78-7
Purity:95% Package:5mg;10mg;25mg;50mg
|
| Company Name: |
Okeanos Tech Co,. Ltd. Gold
|
| Tel: |
01062651721 18610486005 |
| Email: |
info@okeanos.com.cn |
| Products Intro: |
Product Name:lipo Cy7(Me)
CAS:1144107-78-7
Purity:97% HPLC Package:1g;5g;10g;25g;
|
Cyanine7 carboxylic acid manufacturers
|
| | Cyanine7 carboxylic acid Basic information |
| Product Name: | Cyanine7 carboxylic acid | | Synonyms: | Cyanine7 carboxylic acid;Cyanine7-COOH;lipo Cy7(Me);6-[(Z)-3,3-dimethyl-2-[(2E,4E,6E)-7-(1,3,3-trimethyl-3H-indol-1-ium-2-yl)hepta-2,4,6-trien-1-ylidene]indolin-1-yl]hexanoate;6-(3，3-Dimethyl-2-(7-(1，3，3-trimethyl-3H-indol-1-ium-2-YL)hepta-2，4，6-trien-1-ylidene)indolin-1-YL)hexanoate;Cy7-M Free Acid (NIR) | | CAS: | 1144107-78-7 | | MF: | C34H40N2O2 | | MW: | 508.71 | | EINECS: | | | Product Categories: | | | Mol File: | 1144107-78-7.mol |  |
| | Cyanine7 carboxylic acid Chemical Properties |
| solubility | Soluble in organic solvents such as DMF | | Appearance | Green solid | | ex/em | 740/770 nm (MeOH/PBS) | | ε(extinction coefficient) | 199000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.3 | | InChIKey | MQMHUMKZLAOASA-UHFFFAOYSA-N | | SMILES | C(N1C(C(C)(C)C2=CC=CC=C12)=CC=CC=CC=CC1C(C2=CC=CC=C2[N+]=1C)(C)C)CCCCC(=O)[O-] |
| | Cyanine7 carboxylic acid Usage And Synthesis |
| Description | The unactivated free carboxylic acid of near-infrared fluorescent dye Cyanine7. For coupling and labeling reactions also consider using pre-activated Cyanine7 NHS ester, or water-soluble sulfo-Cyanine7 NHS ester. | | Chemical Properties | Appearance: Green solid
ex/em: 740/770 nm (MeOH/PBS)
Extinction coefficient (ε): 199000 Lmol1cm1
Quantum yield (Φ): 0.3 | | Uses | Cyanine7 carboxylic acid (Cy7 COOH) is a derivative of Cy7 (HY-D0825) dye. Cyanine7 carboxylic acid contains carboxyl groups, which can condense ammonia to form covalent bonds[1]. | | References | [1] Zhang X, et al. Highly stable near-infrared dye conjugated cerasomes for fluorescence imaging-guided synergistic chemo-photothermal therapy of colorectal cancer. Biomater Sci. 2019 Jul 1;7(7):2873-2888. DOI:10.1039/c9bm00458k | | Abs/Em Maxima | 750/773 nm | | Extinction Coefficient | 199000 | | CF260 | 0.022 | | CF280 | 0.029 |
| | Cyanine7 carboxylic acid Preparation Products And Raw materials |
|