Cyanine5 carboxylic acid manufacturers
|
| | Cyanine5 carboxylic acid Basic information |
| Product Name: | Cyanine5 carboxylic acid | | Synonyms: | Cyanine5 carboxylic acid;2-((1E)-5-(1-(5-carboxypentyl)-3,3-dimethylindolin-2-ylidene)penta-1,3-dien-1-yl)-1,3,3-trimethyl-3H-indol-1-ium chloride;2-(5-(1-(5-Carboxypentyl)-3,3-dimethylindolin-2-ylidene)penta-1,3-dien-1-yl)-1,3,3-trimethyl-3H-indol-1-ium chloride;Cyanine5 COOH;CY5 (non-sulfonated);lipo Cy5(Me);CY5-C00H;2-[5-[1-(5-Carboxypentyl)-3,3-dimethylindolin-2-ylidene]-1,3-pentadien-1-yl]-1,3,3-trimethyl-3H-indol-1-ium Chloride | | CAS: | 1032678-07-1 | | MF: | C32H39ClN2O2 | | MW: | 519.13 | | EINECS: | | | Product Categories: | | | Mol File: | 1032678-07-1.mol |  |
| | Cyanine5 carboxylic acid Chemical Properties |
| solubility | Soluble in DMSO, DMF, DCM | | form | Solid | | color | Brown to black | | Appearance | Dark blue solid | | ex/em | 640/664nm (PBS buffer) | | ε(extinction coefficient) | 250000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.2 | | InChIKey | SHDOHVMHEAVMNK-UHFFFAOYSA-N | | SMILES | C(N1C(C(C)(C)C2=CC=CC=C12)=CC=CC=CC1C(C2=CC=CC=C2[N+]=1C)(C)C)CCCCC(=O)O.[Cl-] |
| | Cyanine5 carboxylic acid Usage And Synthesis |
| Description | Cy5 acid is a dye containing a non-activated carboxylic acid. This dye has limited water solubility, but can be dissolved in mixtures of water with organic phase (DMF, DMSO, alcohols) to obtain useful concentrations of the material in solution. This molecule can be considered non-reactive dye for the use in control samples, and for instrument calibration. | | Chemical Properties | Appearance: Dark blue solid ex/em: 640/664nm (PBS buffer) Extinction coefficient (ε): 250000 Lmol1cm1 Quantum yield (Φ): 0.2 |
| | Cyanine5 carboxylic acid Preparation Products And Raw materials |
|