| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Choline-1,1,2,2-d4 BroMide CAS:285979-69-3 Remarks:CS-C-00853
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Choline-1,1,2,2-d4 bromide CAS:285979-69-3 Purity:98 atom % D Package:1G Remarks:615552-1G
|
|
| | CHOLINE-1,1,2,2-D4 BROMIDE Basic information |
| Product Name: | CHOLINE-1,1,2,2-D4 BROMIDE | | Synonyms: | CHOLINE-1,1,2,2-D4 BROMIDE;trimethyl-(1,1,2,2-tetradeuterio-2-hydroxyethyl)azanium;Choline-1,1,2,2-d?bromide;Choline-1,1,2,2-d4 bromide | | CAS: | 285979-69-3 | | MF: | C5H14BrNO | | MW: | 184.08 | | EINECS: | 693-581-0 | | Product Categories: | Alphabetical Listings;CStable Isotopes;Metabolic Research;Other;Stable Isotopes | | Mol File: | 285979-69-3.mol |  |
| | CHOLINE-1,1,2,2-D4 BROMIDE Chemical Properties |
| Melting point | 289 - 290°C | | storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere | | solubility | DMF (Slightly, Heated), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C5H14NO.BrH/c1-6(2,3)4-5-7;/h7H,4-5H2,1-3H3;1H/q+1;/p-1/i4D2,5D2; | | InChIKey | JJCWKVUUIFLXNZ-HGFPCDIYSA-M | | SMILES | [Br-].[2H]C([2H])(O)C([2H])([2H])[N+](C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CHOLINE-1,1,2,2-D4 BROMIDE Usage And Synthesis |
| Uses | Choline-1,1,2,2-d4 Bromide (CAS# 285979-69-3) is a useful isotopically labeled research compound. |
| | CHOLINE-1,1,2,2-D4 BROMIDE Preparation Products And Raw materials |
|