|
|
| | Choline chloride (trimethyl-d9) Basic information |
| | Choline chloride (trimethyl-d9) Chemical Properties |
| Melting point | 302-305 °C (dec.)(lit.) | | storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic | | InChI | 1S/C5H14NO.ClH/c1-6(2,3)4-5-7;/h7H,4-5H2,1-3H3;1H/q+1;/p-1/i1D3,2D3,3D3; | | InChIKey | SGMZJAMFUVOLNK-KYRNGWDOSA-M | | SMILES | [Cl-].[2H]C([2H])([2H])[N+](CCO)(C([2H])([2H])[2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 67-48-1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Choline chloride (trimethyl-d9) Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Labelled Choline. Lipotropic. |
| | Choline chloride (trimethyl-d9) Preparation Products And Raw materials |
|