|
|
| | CHOLINE BROMIDE (D13) Basic information |
| Product Name: | CHOLINE BROMIDE (D13) | | Synonyms: | CHOLINE-D13 BROMIDE (N,N,N-TRIMETHYL-D9, 1,1,2,2-D4);CHOLINE BROMIDE (D13);CHOLINE BROMIDE-(TRIMETHYL-D9,1,1,2,2-D4);(1,1,2,2-tetradeuterio-2-hydroxyethyl)-tris(trideuteriomethyl)azanium;Choline-d13 BroMide;Choline-d13 bromide-(N,N,N-trimethyl-d9,1,1,2,2-d4);Choline bromide (D??, 98%) | | CAS: | 203645-64-1 | | MF: | C5HBrD13NO | | MW: | 197.15 | | EINECS: | 693-587-3 | | Product Categories: | Alphabetical Listings;CStable Isotopes;Metabolic Research;Other;Stable Isotopes | | Mol File: | 203645-64-1.mol |  |
| | CHOLINE BROMIDE (D13) Chemical Properties |
| form | solid | | InChI | 1S/C5H14NO.BrH/c1-6(2,3)4-5-7;/h7H,4-5H2,1-3H3;1H/q+1;/p-1/i1D3,2D3,3D3,4D2,5D2; | | InChIKey | JJCWKVUUIFLXNZ-TYBPHYHNSA-M | | SMILES | [Br-].[2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])O | | CAS Number Unlabeled | 06/06/1927 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CHOLINE BROMIDE (D13) Usage And Synthesis |
| Uses | Choline-d13 (bromide) is the deuterium labeled Choline bromide[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | CHOLINE BROMIDE (D13) Preparation Products And Raw materials |
|