|
|
| | FMOC-L-4-THIAZOLYLALANINE Basic information |
| | FMOC-L-4-THIAZOLYLALANINE Chemical Properties |
| Melting point | 178.2 °C | | Boiling point | 647.5±55.0 °C(Predicted) | | density | 1.378±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.6930 (estimate) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.42±0.10(Predicted) | | form | solid | | color | White | | Major Application | peptide synthesis | | InChI | 1S/C21H18N2O4S/c24-20(25)19(9-13-11-28-12-22-13)23-21(26)27-10-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,11-12,18-19H,9-10H2,(H,23,26)(H,24,25)/t19-/m0/s1 | | InChIKey | LSBAZFASKHLHKB-IBGZPJMESA-N | | SMILES | OC(=O)[C@H](Cc1cscn1)NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 205528-32-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29342000 | | Storage Class | 13 - Non Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | FMOC-L-4-THIAZOLYLALANINE Usage And Synthesis |
| Chemical Properties | white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-L-4-THIAZOLYLALANINE Preparation Products And Raw materials |
|