|
|
| | FMOC-L-4-CYANOPHENYLALANINE Basic information |
| | FMOC-L-4-CYANOPHENYLALANINE Chemical Properties |
| Melting point | 189 °C | | Boiling point | 531.88°C (rough estimate) | | density | 1.2691 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | 2-8°C | | pka | 3.62±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | Consistent with structure | | BRN | 7500424 | | Major Application | peptide synthesis | | InChIKey | JOPKKUTWCGYCDA-QHCPKHFHSA-N | | SMILES | OC(=O)[C@H](Cc1ccc(cc1)C#N)NC(=O)OCC2c3ccccc3-c4ccccc24 | | CAS DataBase Reference | 173963-93-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2926 90 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | FMOC-L-4-CYANOPHENYLALANINE Usage And Synthesis |
| Chemical Properties | white powder | | Uses | Fmoc-L-4-cyanophenylalanine can be used as neuroprotective compounds. | | General Description | Starting amino acid for the preparation of 4-(tetrazol-5-yl-)-phenylalanine. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-L-4-CYANOPHENYLALANINE Preparation Products And Raw materials |
|