|
|
| | (-)-Camphanic acid chloride Basic information |
| | (-)-Camphanic acid chloride Chemical Properties |
| Melting point | 71-73 °C(lit.) | | alpha | -18 º (c=2, CCl4) | | Boiling point | 310.92°C (rough estimate) | | density | 1.2072 (rough estimate) | | refractive index | 1.5390 (estimate) | | storage temp. | 2-8°C | | solubility | soluble in Dichloromethane, Ether, Ethyl Acetate, Methanol | | form | Powder | | color | Yellow to orange-brown | | Optical Rotation | [α]23/D 18°, c = 2 in carbon tetrachloride | | Water Solubility | decomposes | | Sensitive | Moisture Sensitive | | BRN | 3590860 | | InChI | 1S/C10H13ClO3/c1-8(2)9(3)4-5-10(8,6(11)12)14-7(9)13/h4-5H2,1-3H3/t9-,10+/m0/s1 | | InChIKey | PAXWODJTHKJQDZ-RGURZIINSA-N | | SMILES | CC1(C)[C@@]2(C)CC[C@@]1(OC2=O)C(Cl)=O | | CAS DataBase Reference | 39637-74-6(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-29 | | Safety Statements | 26-36/37/39-45-8-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29322090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | (-)-Camphanic acid chloride Usage And Synthesis |
| Chemical Properties | Off-White Powder | | Uses | An optically active resolving agent | | Uses | (1S)-(-)-Camphanic chloride is used as a resolving agent for alcohols as the diastereomeric esters by crystallization or chromatography and as a chiral derivatization reagent for determination of enantiomeric excess of alcohols and amines. | | Uses | (1S)-(-)-Camphanic chloride may be used in esterification of enantiomers in volatiles releasedf from wheat, in order to determine the proportion of enantiomers and also in quantifying the esters. | | General Description | (1S)-(-)-Camphanic chloride is a chiral derivatizing agent. It can be prepared by reacting (-)-(1S,4R)-camphanic acid with thionyl chloride. | | Purification Methods | It is soluble in toluene (50g/100mL at 0o) and crystallises from pet ether (b 40-60o). It sublimes at 70o/5mm, Store it dry at 0o, max (CCl4) 1805s and 1780m cm-1. Armarego et al. J Chem Soc, Perkin Trans I 2229 1976, Gerlach Helv Chim Acta 51 1587 1968, Gerlach Helv Chim Acta 68 1815 1985, Beilstein 18/8 V 101.] |
| | (-)-Camphanic acid chloride Preparation Products And Raw materials |
|