- Boc-L-Chg-OL
-
-
2026-07-29
- CAS:107202-39-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | N-BOC-L-CYCLOHEXYLGLYCINOL Basic information |
| | N-BOC-L-CYCLOHEXYLGLYCINOL Chemical Properties |
| Melting point | 83-87 °C(lit.) | | Boiling point | 371.2±25.0 °C(Predicted) | | density | 1.037 | | storage temp. | Sealed in dry,2-8°C | | pka | 12.07±0.46(Predicted) | | form | solid | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D -13°, c = 1% in chloroform | | Major Application | peptide synthesis | | InChI | 1S/C13H25NO3/c1-13(2,3)17-12(16)14-11(9-15)10-7-5-4-6-8-10/h10-11,15H,4-9H2,1-3H3,(H,14,16)/t11-/m1/s1 | | InChIKey | YNBRORWNNGUYQA-LLVKDONJSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CO)C1CCCCC1 | | CAS DataBase Reference | 107202-39-1 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2906190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-BOC-L-CYCLOHEXYLGLYCINOL Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-BOC-L-CYCLOHEXYLGLYCINOL Preparation Products And Raw materials |
|