- AI3-17671
-
- $29.00 / 5g
-
2026-04-20
- CAS:101-92-8
- Min. Order:
- Purity: 99.79%
- Supply Ability: 10g
|
| | 4'-Chloroacetoacetanilide Basic information |
| | 4'-Chloroacetoacetanilide Chemical Properties |
| Melting point | 131-134 °C (lit.) | | Boiling point | 303°C (rough estimate) | | density | 1.44 g/cm3 (20℃) | | vapor density | 7.31 | | refractive index | 1.5388 (estimate) | | Fp | 350°F(COC) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | acetone: soluble25mg/mL, clear, colorless to light yellow | | pka | 11.00±0.46(Predicted) | | form | Crystalline Powder | | color | Off-white to beige | | InChI | 1S/C10H10ClNO2/c1-7(13)6-10(14)12-9-4-2-8(11)3-5-9/h2-5H,6H2,1H3,(H,12,14) | | InChIKey | JMRJWEJJUKUBEA-UHFFFAOYSA-N | | SMILES | CC(=O)CC(=O)Nc1ccc(Cl)cc1 | | CAS DataBase Reference | 101-92-8(CAS DataBase Reference) | | NIST Chemistry Reference | Butanamide, N-(4-chlorophenyl)-3-oxo-(101-92-8) | | EPA Substance Registry System | Butanamide, N-(4-chlorophenyl)-3-oxo- (101-92-8) |
| Safety Statements | 24/25 | | WGK Germany | 1 | | RTECS | AK4375000 | | TSCA | TSCA listed | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids | | Hazardous Substances Data | 101-92-8(Hazardous Substances Data) | | Toxicity | ipr-mus LDLo 500 mg/kg CBCCT* 4,225,52 |
| | 4'-Chloroacetoacetanilide Usage And Synthesis |
| Chemical Properties | off-white to beige crystalline powder | | Uses | 4′-Chloroacetoacetanilide was used in recombinant androgen receptor competitive binding assay for analysis of natural, synthetic and environmental chemicals. | | Definition | ChEBI: P-Chloroacetoacetanilide is an anilide. | | General Description | 4′-Chloroacetoacetanilide was trilithiated with lithium diisopropylamide and condensed with several aromatic esters, followed by neutralization, separate acid cyclization and rearrangements to yield 4-anilino-6-aryl-2H-pyran-2-ones. It undergoes three-component reaction with a mixture of aromatic aldehyde and 5-aminotetrazole to form N,7-diaryl-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxamide. | | Safety Profile | Moderately toxic by intraperitonealroute. Combustible whenexposed to heat or flame. Dangerous: see ANILINE andCYANIDE. Can react vigorously with oxidizing materials.To fight fire, use water, foam, CO2, water mist, drychemical. When heated to decompo |
| | 4'-Chloroacetoacetanilide Preparation Products And Raw materials |
|