| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-Bromo-2,3,5-trifluorobenzene Basic information |
| Product Name: | 1-Bromo-2,3,5-trifluorobenzene | | Synonyms: | 2,3,5-TRIFLUOROBROMOBENZENE;1-BROMO-2,3,5-TRIFLUOROBENZENE;,3,5-Trifluorobromobenzene;1-Bromo-2,3,5-trifluorobenzene 98%;1-Bromo-2,3,5-trifluorobenzene98%;1-Bromo-2,3,5-triflu;2,3,5-Trifluorobromobenzene 98%;2,3,5-Trifluorobromobenzene98% | | CAS: | 133739-70-5 | | MF: | C6H2BrF3 | | MW: | 210.98 | | EINECS: | 623-354-3 | | Product Categories: | Aryl;Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Aromatic Hydrocarbons (substituted) & Derivatives;Miscellaneous;C6 | | Mol File: | 133739-70-5.mol |  |
| | 1-Bromo-2,3,5-trifluorobenzene Chemical Properties |
| Boiling point | 143℃ | | density | 1.758 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.486(lit.) | | Fp | 89 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Liquid | | color | Colorless to yellow | | Specific Gravity | 1.758 | | BRN | 7369071 | | InChI | InChI=1S/C6H2BrF3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H | | InChIKey | XSMLLZPSNLQCQU-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(F)=CC(F)=C1F | | CAS DataBase Reference | 133739-70-5(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36/37/39-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2903998090 |
| | 1-Bromo-2,3,5-trifluorobenzene Usage And Synthesis |
| Chemical Properties | clear slightly yellow liquid | | Uses |
1-Bromo-2,3,5-trifluorobenzene is mainly used in organic synthesis.
|
| | 1-Bromo-2,3,5-trifluorobenzene Preparation Products And Raw materials |
|