| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Cyclopentadienyltitanium trichloride Basic information |
| | Cyclopentadienyltitanium trichloride Chemical Properties |
| Melting point | 210 °C (dec.) (lit.) | | refractive index | 1.47 | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Crystalline | | color | Yellow-orange | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C5H5.3ClH.Ti/c1-2-4-5-3-1;;;;/h1-5H;3*1H;/q;;;;+3/p-3 | | InChIKey | AENCLWKVWIIOQH-UHFFFAOYSA-K | | SMILES | Cl[Ti](Cl)Cl.[CH]1[CH][CH][CH][CH]1 | | CAS DataBase Reference | 1270-98-0(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | XR1927300 | | F | 10-21 | | TSCA | No | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29310099 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B | | Toxicity | mouse,LD50,parenteral,130mg/kg (130mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 19, Pg. 347, 1984. |
| | Cyclopentadienyltitanium trichloride Usage And Synthesis |
| Chemical Properties | yellow to orange crystals or crystalline powder | | Uses | Precursor for cyclopentadienyltitanium(IV) complexes, and used as catalysts for alkene polymerizations. | | reaction suitability | core: titanium reagent type: catalyst |
| | Cyclopentadienyltitanium trichloride Preparation Products And Raw materials |
|