PYR-PNA manufacturers
- PYR-PNA
-
-
2026-09-08
- CAS:66642-35-1
- Min. Order: 5g
- Purity: 98%
- Supply Ability: 500kg/M
|
| | PYR-PNA Basic information |
| Product Name: | PYR-PNA | | Synonyms: | PGLU-PNA;PYR-PNA;PYROGLUTAMIC ACID-PNA;PYROGLUTAMIC ACID P-NITRO-ANILIDE;L-Pyroglutamic acid 4-nitroanilide≥ 99% (HPLC);L-Pyr-pNA;(S)-N-(4-Nitrophenyl)-5-oxopyrrolidine-2-carboxamide;L-PYROGLUTAMIC ACID 4-NITROANILIDE | | CAS: | 66642-35-1 | | MF: | C11H11N3O4 | | MW: | 249.22 | | EINECS: | | | Product Categories: | Activity;Enzyme Substrates;Fluorogenic | | Mol File: | 66642-35-1.mol |  |
| | PYR-PNA Chemical Properties |
| storage temp. | Sealed in dry,2-8°C | | solubility | DMF: 50mg/mL, clear, colorless to faintly yellow | | form | powder | | InChI | InChI=1S/C11H11N3O4/c15-10-6-5-9(13-10)11(16)12-7-1-3-8(4-2-7)14(17)18/h1-4,9H,5-6H2,(H,12,16)(H,13,15)/t9-/m0/s1 | | InChIKey | HGNBEWLBSCSJGV-VIFPVBQESA-N | | SMILES | N1C(=O)CC[C@H]1C(NC1=CC=C([N+]([O-])=O)C=C1)=O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29337900 | | Storage Class | 11 - Combustible Solids |
| | PYR-PNA Usage And Synthesis |
| Chemical Properties | Light yellow crystalline powder | | Uses | Substrate for pyrrolidonylpeptidase. |
| | PYR-PNA Preparation Products And Raw materials |
|