| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Gly-Phe p-nitroanilide Basic information |
| | Gly-Phe p-nitroanilide Chemical Properties |
| Boiling point | 691.8±55.0 °C(Predicted) | | density | 1.344±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 50mg/mL, clear, yellow | | pka | 12.54±0.70(Predicted) | | form | powder | | biological source | rabbit | | InChI | 1S/C17H18N4O4/c18-11-16(22)20-15(10-12-4-2-1-3-5-12)17(23)19-13-6-8-14(9-7-13)21(24)25/h1-9,15H,10-11,18H2,(H,19,23)(H,20,22) | | InChIKey | KNDZCZRECXTRHP-UHFFFAOYSA-N | | SMILES | NCC(=O)NC(Cc1ccccc1)C(=O)Nc2ccc(cc2)N(=O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Gly-Phe p-nitroanilide Usage And Synthesis |
| Chemical Properties | Slightly yellowish to white powder | | Uses | Substrate for dipeptidyl aminopeptidase I (cathepsin C). | | Uses | Substrate for intralysomal hydrolysis by cathepsin C. |
| | Gly-Phe p-nitroanilide Preparation Products And Raw materials |
|