| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
| Company Name: |
Novachemistry |
| Tel: |
44-20819178-90 02081917890 |
| Email: |
info@novachemistry.com |
|
| | Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate Basic information |
| Product Name: | Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate | | Synonyms: | Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate >=99.0% (HPLC);1,2-Hydrazinedicarboxylic acid, 1-[(1,1-dimethylethyl)thio]-, 1,2-bis(1,1-dimethylethyl) ester;Di-tert-butyl 1-(tert-butylthio)hydrazine-1,2-dicarboxylate;Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate;Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate | | CAS: | 84592-35-8 | | MF: | C14H28N2O4S | | MW: | 320.45 | | EINECS: | | | Product Categories: | Amine ProtectionProtection and Derivatization;Others;Peptide Synthesis;Protecting and Derivatizing Reagents;Specialty Synthesis | | Mol File: | 84592-35-8.mol |  |
| | Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate Chemical Properties |
| Melting point | 98-100 °C | | density | 1.079±0.06 g/cm3(Predicted) | | pka | 7.56±0.50(Predicted) | | BRN | 9559826 | | Major Application | peptide synthesis | | InChI | 1S/C14H28N2O4S/c1-12(2,3)19-10(17)15-16(21-14(7,8)9)11(18)20-13(4,5)6/h1-9H3,(H,15,17) | | InChIKey | MOWYOPQOADUFLA-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NN(SC(C)(C)C)C(=O)OC(C)(C)C |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate Usage And Synthesis |
| | Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate Preparation Products And Raw materials |
|