| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
3-(4-tert-Butyl-phenyl)-propionic acid manufacturers
|
| | 3-(4-tert-Butyl-phenyl)-propionic acid Basic information |
| Product Name: | 3-(4-tert-Butyl-phenyl)-propionic acid | | Synonyms: | 3-(4-TERT-BUTYLPHENYL)PROPANOIC ACID;TIMTEC-BB SBB011149;ASINEX-REAG BAS 14742592;(4-tert-Butylbenzyl)acetic Acid;p-tert-Butyl-hydrocinnaMic Acid;4-(1,1-dimethylethyl)Benzenepropanoic acid;Benzenepropanoic acid, 4-(1,1-dimethylethyl)-;3-(4-tert-Butylphenyl)propionicacid,97% | | CAS: | 1208-64-6 | | MF: | C13H18O2 | | MW: | 206.28 | | EINECS: | | | Product Categories: | Aromatics | | Mol File: | 1208-64-6.mol |  |
| | 3-(4-tert-Butyl-phenyl)-propionic acid Chemical Properties |
| Melting point | 95°C | | Boiling point | 318.6±11.0 °C(Predicted) | | density | 1.031±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Chloroform, Dichloromethane | | form | Solid | | pka | 4.70±0.10(Predicted) | | color | White | | InChI | InChI=1S/C13H18O2/c1-13(2,3)11-7-4-10(5-8-11)6-9-12(14)15/h4-5,7-8H,6,9H2,1-3H3,(H,14,15) | | InChIKey | BNJYANVQFVSYEK-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=C(C(C)(C)C)C=C1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 3-(4-tert-Butyl-phenyl)-propionic acid Usage And Synthesis |
| Chemical Properties | White Solid |
| | 3-(4-tert-Butyl-phenyl)-propionic acid Preparation Products And Raw materials |
|