|
|
| | 3,4-(Methylenedioxy)cinnamic acid Basic information |
| Product Name: | 3,4-(Methylenedioxy)cinnamic acid | | Synonyms: | 3-(Benzo[d][1,3]dioxol-5-yl)acrylic acid;3-(3,4-Methylene-dioxphenyl)acrylicacid;3-(3,4-Methylenedioxyphenyl)propenoic acid;3-(3,4-Methylenedioxyphenyl)propenoicacid;(2E)-3-(1,3-benzodioxol-5-yl)prop-2-enoic acid;3,4-Methylenedioxybenzene-3-acrylic acid;Acetic acid, piperonylidene-;Cinnamic acid, 3,4-(methylenebis(oxy))- | | CAS: | 2373-80-0 | | MF: | C10H8O4 | | MW: | 192.17 | | EINECS: | 219-151-0 | | Product Categories: | Aromatic Cinnamic Acids, Esters and Derivatives;Cinnamic acid;C10;Carbonyl Compounds;Carboxylic Acids;Building Blocks;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks | | Mol File: | 2373-80-0.mol |  |
| | 3,4-(Methylenedioxy)cinnamic acid Chemical Properties |
| Melting point | 242-244 °C (dec.)(lit.) | | Boiling point | 248.14°C (rough estimate) | | density | 1.0825 (rough estimate) | | refractive index | 1.4440 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | very faint turbidity in Pyridine | | form | powder to crystal | | pka | 4.37±0.10(Predicted) | | color | White to Light yellow | | BRN | 84599 | | InChI | InChI=1S/C10H8O4/c11-10(12)4-2-7-1-3-8-9(5-7)14-6-13-8/h1-5H,6H2,(H,11,12) | | InChIKey | QFQYZMGOKIROEC-DUXPYHPUSA-N | | SMILES | C(O)(=O)C=CC1=CC=C2OCOC2=C1 | | CAS DataBase Reference | 2373-80-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3,4-Methylenedioxycinnamic acid(2373-80-0) |
| Hazard Codes | Xi | | Risk Statements | 38-36/37/38 | | Safety Statements | 36-24/25-37-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | 3,4-(Methylenedioxy)cinnamic acid Usage And Synthesis |
| Chemical Properties | white to light yellow granular powder | | Uses | 3,4-(Methylenedioxy)cinnamic acid, predominantly trans is an inhibitor of the phenylpropanoid enzyme 4-hydroxycinnamoyl-CoA ligase. | | Definition | ChEBI: Methylenedioxycinnamic acid is a hydroxycinnamic acid. | | General Description | 3,4-(Methylenedioxy)cinnamic acid is an inhibitor of the phenylpropanoid enzyme 4-hydroxycinnamoyl-CoA ligase. It undergoes electron transfer reaction with trichloromethylperoxyl radical and reaction has been studied by pulse radiolysis. | | Purification Methods | Crystallise the acid from glacial AcOH, EtOH (m 247o) or aqueous EtOH (m 240-242o), and it has m 242o after sublimation. [Beilstein 19 H 278, 19 II 299, 19 III/IV 3548.] |
| | 3,4-(Methylenedioxy)cinnamic acid Preparation Products And Raw materials |
|