|
|
| | 1,4-Butanediol-2,2,3,3-d4 Basic information |
| Product Name: | 1,4-Butanediol-2,2,3,3-d4 | | Synonyms: | 1,4-BUTANE-2,2,3,3-D4-DIOL;1,4-BUTANEDIOL (2,2,3,3-D4, 98%);1,4-BUTANEDIOL-2,2,3,3-D4, 98 ATOM % D;1,4-BUTANEDIOL-2,2,3,3-D4 (D, 98%);2,2,3,3-tetradeuteriobutane-1,4-diol;1,4-Butanediol-2,2,3,3-d4;1,4-Butanediol-2,2,3,3-D? (D, 98%);1,4-Butanediol-2,2,3,3-d4 | | CAS: | 38274-25-8 | | MF: | C4H6D4O2 | | MW: | 94.15 | | EINECS: | | | Product Categories: | Alphabetical Listings;B;Stable Isotopes | | Mol File: | 38274-25-8.mol |  |
| | 1,4-Butanediol-2,2,3,3-d4 Chemical Properties |
| Melting point | 16 °C(lit.) | | Boiling point | 230 °C(lit.) | | density | 1.062 g/mL at 25 °C | | refractive index | n20/D 1.4452(lit.) | | Fp | >230 °F | | InChI | 1S/C4H10O2/c5-3-1-2-4-6/h5-6H,1-4H2/i1D2,2D2 | | InChIKey | WERYXYBDKMZEQL-LNLMKGTHSA-N | | SMILES | [2H]C([2H])(CO)C([2H])([2H])CO | | CAS Number Unlabeled | 110-63-4 |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-67-22 | | Safety Statements | 26-37/39-36-23 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral STOT SE 3 |
| | 1,4-Butanediol-2,2,3,3-d4 Usage And Synthesis |
| | 1,4-Butanediol-2,2,3,3-d4 Preparation Products And Raw materials |
|