| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Dimethyl succinate-d4 manufacturers
|
| | Dimethyl succinate-d4 Basic information |
| Product Name: | Dimethyl succinate-d4 | | Synonyms: | DIMETHYL SUCCINATE-2,2,3,3-D4;DIMETHYL SUCCINATE-2,2,3,3-D4, 98 ATOM % D;dimethyl butanedioate-2,2,3,3-d4;Dimethyl succinate-2,2,3,3-d?;Dimethyl succinate-2,2,3,3-d4;Dimethyl succinate-d4 | | CAS: | 30994-23-1 | | MF: | C6H6D4O4 | | MW: | 150.17 | | EINECS: | 202-110-6 | | Product Categories: | | | Mol File: | 30994-23-1.mol |  |
| | Dimethyl succinate-d4 Chemical Properties |
| Melting point | 18-19 °C(lit.) | | Boiling point | 200 °C(lit.) | | density | 1.148 g/mL at 25 °C | | refractive index | n20/D 1.419(lit.) | | Fp | 185 °F | | solubility | Chloroform (Slightly) | | form | Oil | | color | Colourless | | InChI | 1S/C6H10O4/c1-9-5(7)3-4-6(8)10-2/h3-4H2,1-2H3/i3D2,4D2 | | InChIKey | MUXOBHXGJLMRAB-KHORGVISSA-N | | SMILES | [2H]C([2H])(C(=O)OC)C([2H])([2H])C(=O)OC |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Dimethyl succinate-d4 Usage And Synthesis |
| Uses | Dimethyl Succinate-d4 (CAS# 30994-23-1) is a useful isotopically labeled research compound. |
| | Dimethyl succinate-d4 Preparation Products And Raw materials |
|