| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
Oseltamivir EP Impurity E HCl manufacturers
|
| | Oseltamivir EP Impurity E HCl Basic information |
| Product Name: | Oseltamivir EP Impurity E HCl | | Synonyms: | Oseltamivir Methyl Ester HCl;methyl (3R,4R,5S)-4-acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylate;Oseltamivir EP Impurity E HCl;methyl(3R,4R,5S)-4-acetamido-5-amino-3-(1-ethyl-propxy)cyclohex-1-ene-1-carboxlate;(3R,4R,5S)-methyl 4-acetamido-5-amino;Oseltamivir EP Impurity E:Oseltamivir Impurity E;Oseltamivir Impurity(Oseltamivir EP Impurity E);Oseltamivir EP Impuruty E | | CAS: | 208720-78-9 | | MF: | C15H27ClN2O4 | | MW: | 334.84 | | EINECS: | | | Product Categories: | | | Mol File: | 208720-78-9.mol |  |
| | Oseltamivir EP Impurity E HCl Chemical Properties |
| InChI | InChI=1/C15H26N2O4.ClH/c1-5-11(6-2)21-13-8-10(15(19)20-4)7-12(16)14(13)17-9(3)18;/h8,11-14H,5-7,16H2,1-4H3,(H,17,18);1H/t12-,13+,14+;/s3 | | InChIKey | VXUUEBWFJPUQGY-XGEKKEJANA-N | | SMILES | O([C@@H]1C=C(C(=O)OC)C[C@H](N)[C@H]1NC(=O)C)C(CC)CC.Cl |&1:1,9,11,r| |
| | Oseltamivir EP Impurity E HCl Usage And Synthesis |
| Uses | Oseltamivir acid methyl ester hydrochloride is a precursor form of the neuraminidase inhibitor and antiviral oseltamivir acid. Oseltamivir acid methyl ester hydrochloride is converted to oseltamivir acid by carboxylesterase 1 (CES1)[1]. | | References | [1] Mai Shimizu, et al. Systematic Approach for Screening of Prodrugs: Evaluation Using Oseltamivir Analogues as Models. J Pharm Sci. 2021 Feb;110(2):925-934. DOI:10.1016/j.xphs.2020.10.018 |
| | Oseltamivir EP Impurity E HCl Preparation Products And Raw materials |
|