| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 4-Pentylcyclohexanone
-
- $2.20
-
2026-08-25
- CAS:61203-83-6
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 1000kg
- 4-Pentylcyclohexanone
-
- $9.00
-
2026-05-28
- CAS:61203-83-6
- Min. Order: 1KG
- Purity: 99.8%
- Supply Ability: 100tons
|
| | 4-Pentylcyclohexanone Basic information |
| | 4-Pentylcyclohexanone Chemical Properties |
| Boiling point | 237.1±8.0 °C(Predicted) | | density | 0,89 g/cm3 | | vapor pressure | 2Pa at 20℃ | | refractive index | 1.4540 to 1.4580 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.89 | | Water Solubility | 110mg/L at 20℃ | | InChI | InChI=1S/C11H20O/c1-2-3-4-5-10-6-8-11(12)9-7-10/h10H,2-9H2,1H3 | | InChIKey | UKLNPJDLSPMJMQ-UHFFFAOYSA-N | | SMILES | C1(=O)CCC(CCCCC)CC1 | | LogP | 4.5 at 20℃ | | CAS DataBase Reference | 61203-83-6(CAS DataBase Reference) |
| Hazard Codes | N | | Risk Statements | 51/53 | | Safety Statements | 61 | | RIDADR | 3082 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29142990 |
| Provider | Language |
|
ALFA
| English |
| | 4-Pentylcyclohexanone Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow liquid | | Uses | Intermediates of Liquid Crystals | | Flammability and Explosibility | Not classified |
| | 4-Pentylcyclohexanone Preparation Products And Raw materials |
|