|
|
| | 2-Methyl-1-nonanol Basic information |
| Product Name: | 2-Methyl-1-nonanol | | Synonyms: | 2-heptyl-2-methylethanol;2-Methylnonanol;1-Nonanol, 2-methyl-;2-methylnonan-1-ol;2-Methyl-1-nonanol | | CAS: | 40589-14-8 | | MF: | C10H22O | | MW: | 158.28 | | EINECS: | 254-986-4 | | Product Categories: | | | Mol File: | 40589-14-8.mol |  |
| | 2-Methyl-1-nonanol Chemical Properties |
| Melting point | -1.53°C (estimate) | | Boiling point | 222°C | | density | 0.8454 (estimate) | | refractive index | 1.4116 (estimate) | | pka | 15.06±0.10(Predicted) | | Henry's Law Constant | 3.0×10-2 mol/(m3Pa) at 25℃, Yaws (2003) | | InChI | InChI=1S/C10H22O/c1-3-4-5-6-7-8-10(2)9-11/h10-11H,3-9H2,1-2H3 | | InChIKey | BEGNRPGEHZBNKK-UHFFFAOYSA-N | | SMILES | C(O)C(C)CCCCCCC |
| | 2-Methyl-1-nonanol Usage And Synthesis |
| Uses | 2-Methylnonanol is a catalyst in the preparation of alkylphosphine-containing polyhedral oligosilsesquioxane-based dendrimers as ligands for rhodium catalysts and their application in hydrocarbonylation of alkenes. |
| | 2-Methyl-1-nonanol Preparation Products And Raw materials |
|