| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Methyl-3 5-dinitrobenzyl alcohol 96 Basic information |
| | 4-Methyl-3 5-dinitrobenzyl alcohol 96 Chemical Properties |
| Melting point | 57-61 °C (lit.) | | InChI | 1S/C8H8N2O5/c1-5-7(9(12)13)2-6(4-11)3-8(5)10(14)15/h2-3,11H,4H2,1H3 | | InChIKey | CFABPPYLLXJWIW-UHFFFAOYSA-N | | SMILES | Cc1c(cc(CO)cc1[N+]([O-])=O)[N+]([O-])=O |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 4-Methyl-3 5-dinitrobenzyl alcohol 96 Usage And Synthesis |
| Uses | 4-Methyl-3,5-dinitrobenzyl alcohol is also referred to as (4-methyl-3,5-dinitrophenyl)methanol. | | General Description | 4-Methyl-3,5-dinitrobenzyl alcohol is also referred to as (4-methyl-3,5-dinitrophenyl)methanol. |
| | 4-Methyl-3 5-dinitrobenzyl alcohol 96 Preparation Products And Raw materials |
|