- 3,5-DINITROBENZYL ALCOHOL
-
- $100.00 / 1KG
-
2023-12-26
- CAS:71022-43-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3,5-DINITROBENZYL ALCOHOL Basic information |
| Product Name: | 3,5-DINITROBENZYL ALCOHOL | | Synonyms: | 3,5-Dinitrobenzyl alcohol 98%;3,5-DINITROBENZYL ALCOHOL;(3,5-DINITRO-PHENYL)-METHANOL;3,5-DINITROBENZYL ALCOHOL 98+%;BenzeneMethanol,3,5-dinitro-;3,5-Dinitrobenzenemethanol;3,5-DinitrobenzylAlcohol>;3,5-DINITROBENZYL ALCOHOL ISO 9001：2015 REACH | | CAS: | 71022-43-0 | | MF: | C7H6N2O5 | | MW: | 198.13 | | EINECS: | 275-131-1 | | Product Categories: | Alcohols;C7 to C8;Oxygen Compounds;Benzhydrols, Benzyl & Special Alcohols | | Mol File: | 71022-43-0.mol |  |
| | 3,5-DINITROBENZYL ALCOHOL Chemical Properties |
| Melting point | 88-91 °C (lit.) | | Boiling point | 335.43°C (rough estimate) | | density | 1.560±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.5460 (estimate) | | storage temp. | Store at room temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 13.40±0.10(Predicted) | | color | Light orange to Yellow to Green | | BRN | 2054388 | | InChI | InChI=1S/C7H6N2O5/c10-4-5-1-6(8(11)12)3-7(2-5)9(13)14/h1-3,10H,4H2 | | InChIKey | GPHYIQCSMDYRGJ-UHFFFAOYSA-N | | SMILES | C1(CO)=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 | | CAS DataBase Reference | 71022-43-0(CAS DataBase Reference) |
| | 3,5-DINITROBENZYL ALCOHOL Usage And Synthesis |
| Chemical Properties | slightly yellow amorphous powder and chunks | | Uses | 3,5-Dinitrobenzyl alcohol was used in the synthesis of 3,5-bis((bezoxycarbonyl)imino)benzyl alcohol. | | General Description | 3,5-Dinitrobenzyl alcohol on reaction with p-toluenesulphonyl chloride yields 3,5-dinitrobenzyl p-toluenesulphonate. |
| | 3,5-DINITROBENZYL ALCOHOL Preparation Products And Raw materials |
|