|
|
| | 3,5-Dinitro-4-methylbenzoic acid Basic information |
| Product Name: | 3,5-Dinitro-4-methylbenzoic acid | | Synonyms: | 4-METHYL-3,5-DINITROBENZOIC ACID;3,5-DINITRO-4-METHYLBENZOIC ACID;3,5-DINITRO-4-TOLUIC ACID;3,5-DINITRO-P-TOLUIC ACID;3,5-Dinitro-4-methylbenzoic acid, 3,5-Dinitro-p-toluic acid;3,5-Dinitro-4-methylbenzenecarboxylic acid;3,5-Dinitro-4-toluic acid,98%;Benzoic acid, 4-methyl-3,5-dinitro- | | CAS: | 16533-71-4 | | MF: | C8H6N2O6 | | MW: | 226.14 | | EINECS: | 240-603-8 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;FINE Chemical & INTERMEDIATES;Acids and Derivatives;Carboxylic Acids;Phenyls & Phenyl-Het;Organic acids;Carboxylic Acids;Phenyls & Phenyl-Het | | Mol File: | 16533-71-4.mol |  |
| | 3,5-Dinitro-4-methylbenzoic acid Chemical Properties |
| Melting point | 155-158 °C(lit.) | | Boiling point | 396.3±42.0 °C(Predicted) | | density | 1.593±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | methanol: soluble250mg/10 mL, clear, faintly yellow to yellow | | form | Crystalline Powder | | pka | 2.95±0.10(Predicted) | | color | Yellow | | BRN | 2507949 | | InChI | InChI=1S/C8H6N2O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3H,1H3,(H,11,12) | | InChIKey | LZWWZQXBKVZKIP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=C(C)C([N+]([O-])=O)=C1 | | CAS DataBase Reference | 16533-71-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,5-Dinitro-4-methylbenzoic acid Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 4-Methyl-3,5-dinitrobenzoic acid was used in characterization of the range of highly polar nitroaromatic compounds in water samples from a trinitrotoluene-contaminated waste disposal site. It was used as starting reagent for the asymmetric synthesis of the benzazocine core of FR900482. |
| | 3,5-Dinitro-4-methylbenzoic acid Preparation Products And Raw materials |
|