| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1R,2R)-(+)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 Basic information |
| Product Name: | (1R,2R)-(+)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 | | Synonyms: | methyl-[2-(methylammonio)-1,2-bis[3-(trifluoromethyl)phenyl]ethyl]ammonium;(1R,2R)-(+)-N,N''-DIMETHYL-1,2-BIS3-(TRIFLUOROMETHYL)PHENYL-1,2-ETHANE DIAMINE 99%;(1R,2R)-(+)-N,N'-DIMETHYL-1,2-BIS3-(TRIFLUOROMETHYL)PHENYLa-1,2-ETHANE DIAMINE, 99%;(1R,2R)-(+)-N,N′-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethanediamine
;1,2-Ethanediamine, N1,N2-dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]-, (1R,2R)-;(1R,2R)-N1,N2-dimethyl-1,2-bis(3-(trifluoromethyl)phenyl)ethane-1,2-diamine;(1R,2R)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]ethane-1,2-diamine;(1R,2R)-(+)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl]-1,2-ethane diamine | | CAS: | 137944-39-9 | | MF: | C18H18F6N2 | | MW: | 376.34 | | EINECS: | | | Product Categories: | | | Mol File: | 137944-39-9.mol |  |
| | (1R,2R)-(+)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 Chemical Properties |
| Melting point | 113-115°C | | Boiling point | 348.0±37.0 °C(Predicted) | | density | 1.2608 (estimate) | | storage temp. | 2-8°C, protect from light | | form | powder | | pka | 8.47±0.30(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]22/D +18.0°, c = 1 in chloroform | | InChI | 1S/C18H18F6N2/c1-25-15(11-5-3-7-13(9-11)17(19,20)21)16(26-2)12-6-4-8-14(10-12)18(22,23)24/h3-10,15-16,25-26H,1-2H3/t15-,16-/m1/s1 | | InChIKey | SBGOGHODWUZHIY-HZPDHXFCSA-N | | SMILES | CN[C@@H]([C@H](NC)c1cccc(c1)C(F)(F)F)c2cccc(c2)C(F)(F)F | | CAS DataBase Reference | 137944-39-9 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 24/25-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 29215990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | (1R,2R)-(+)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 Usage And Synthesis |
| Chemical Properties | white powder |
| | (1R,2R)-(+)-N,N'-Dimethyl-1,2-bis[3-(trifluoromethyl)phenyl!-1,2-ethane diamine, 99 Preparation Products And Raw materials |
|