(1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine manufacturers
|
| | (1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine Basic information |
| Product Name: | (1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine | | Synonyms: | (1R,2R)-(+)-N,N'-DIMETHYL-1,2-DIPHENYLETHYLENEDIAMINE;(1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine,99%;(1R,2R)-N,N′-Dimethyl-1,2-diphenylethane-1,2-diamine
;(1R,2R)-N,N'-Dimethyl-1,2-diphenylethane-1,2-diamine 97%;(R,R,)-N,N,-Dimethyl-1,2-Diphenylethylene-1,2-Diamine;(1R,2R-N,N-Dimethyl-1,2-Diphenyl;(R,R)-1,2-Diphenyl-1,2-bis(N-methylamino)ethane.;(1R,2R)-(+)-N,N''-DIMETHYL-1,2-DIPHENYL-1,2-ETHANE DIAMINE 99% | | CAS: | 118628-68-5 | | MF: | C16H20N2 | | MW: | 240.34 | | EINECS: | | | Product Categories: | Chiral Compound | | Mol File: | 118628-68-5.mol |  |
| | (1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine Chemical Properties |
| Melting point | 48-51 °C | | Boiling point | 373.06°C (rough estimate) | | density | 1.0485 (rough estimate) | | refractive index | 1.5519 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.14±0.30(Predicted) | | form | Crystals | | color | White | | Optical Rotation | [α]22/D +17.0°, c = 0.5 in chloroform | | InChI | 1S/C16H20N2/c1-17-15(13-9-5-3-6-10-13)16(18-2)14-11-7-4-8-12-14/h3-12,15-18H,1-2H3/t15-,16-/m1/s1 | | InChIKey | BTHYVQUNQHWNLS-HZPDHXFCSA-N | | SMILES | CN[C@@H]([C@H](NC)c1ccccc1)c2ccccc2 |
| Hazard Codes | C,N,Xn | | Risk Statements | 34-50-22 | | Safety Statements | 45-36/37/39-26-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 29215990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
| Provider | Language |
|
ACROS
| English |
| | (1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine Usage And Synthesis |
| Chemical Properties | white crystals |
| | (1R,2R)-(+)-N,N'-Dimethyl-1,2-diphenyl-1,2-ethane diamine Preparation Products And Raw materials |
|