|
|
| | tetrafluorothianthrene S-oxide Basic information |
| Product Name: | tetrafluorothianthrene S-oxide | | Synonyms: | tetrafluorothianthrene S-oxide;2,3,7,8-Tetrafluorothianthrene 5-oxide;Thianthrene, 2,3,7,8-tetrafluoro-, 5-oxide;2,3,7,8-Tetrafluorothianthrene-S-oxide | | CAS: | 2320491-72-1 | | MF: | C12H4F4OS2 | | MW: | 304.29 | | EINECS: | | | Product Categories: | | | Mol File: | 2320491-72-1.mol |  |
| | tetrafluorothianthrene S-oxide Chemical Properties |
| Melting point | 253 °C | | Boiling point | 408.9±45.0 °C(Predicted) | | density | 1.74±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | solid | | Appearance | White to yellow Solid | | InChI | 1S/C12H4F4OS2/c13-5-1-9-11(3-7(5)15)19(17)12-4-8(16)6(14)2-10(12)18-9/h1-4H | | InChIKey | FJNMYEBXFNFTBJ-UHFFFAOYSA-N | | SMILES | Fc1cc2c(cc1F)Sc3c(cc(c(c3)F)F)[S]2=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | tetrafluorothianthrene S-oxide Usage And Synthesis |
| Uses | 2,3,7,8-Tetrafluorothianthrene-S-oxide (TFT S-oxide) is a fluorinated sulfoxide-based thianthrene reagent for late-stage C-H functionalization. Developed by the Ritter Lab, C-H functionalization by thianthrenation with TFT S-oxide proceeds with >99% selectivity and furnishes functionalized arenes serving as synthetic linchpins for further participation in diverse transformations.
The nonfluorinated thianthrene S-oxide is also available as catalog# 903973 for all arenes more electron-rich than anisole. |
| | tetrafluorothianthrene S-oxide Preparation Products And Raw materials |
|