| Company Name: |
amoymly Gold
|
| Tel: |
18959297324 |
| Email: |
529665659@qq.com |
| Products Intro: |
CAS:2362-50-7
Purity:96+ Package:25g/RMB 650;100g/RMB 2400;250g/RMB 5200
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:thianthrene 5-oxide
CAS:2362-50-7
Purity:97% Package:100mg Remarks:Y69147
|
|
| | thianthrene 5-oxide Basic information |
| Product Name: | thianthrene 5-oxide | | Synonyms: | thianthrene 5-oxide;Thianthrene 10-oxide;Benzothianthrene Oxide;Thianthrene S-oxide | | CAS: | 2362-50-7 | | MF: | C12H8OS2 | | MW: | 232.32 | | EINECS: | | | Product Categories: | | | Mol File: | 2362-50-7.mol |  |
| | thianthrene 5-oxide Chemical Properties |
| Melting point | 143-143.5 °C | | Boiling point | 423.2±15.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | Appearance | White to off-white Solid | | InChI | 1S/C12H8OS2/c13-15-11-7-3-1-5-9(11)14-10-6-2-4-8-12(10)15/h1-8H | | InChIKey | NYVGTLXTOJKHJN-UHFFFAOYSA-N | | SMILES | [S+]1(c2c(cccc2)Sc3c1cccc3)[O-] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | thianthrene 5-oxide Usage And Synthesis |
| Uses | Thianthrene S-oxide is a sulfoxide-based thianthrene reagent for late-stage C-H functionalization. Developed by the Ritter Lab, C-H functionalization by thianthrenation proceeds with >99% selectivity and furnishes functionalized arenes serving as synthetic linchpins for further participation in diverse transformations. Nonfluorinated thianthrene S-oxide is best used for all arenes more electron-rich than anisole. For other arenes, the fluorinated TFT S-oxide (903981) was demonstrated as the thanthrenation reagent. | | Synthesis Reference(s) | Journal of the American Chemical Society, 78, p. 2163, 1956 DOI: 10.1021/ja01591a037
Synthetic Communications, 22, p. 1799, 1992 DOI: 10.1080/00397919208020500 |
| | thianthrene 5-oxide Preparation Products And Raw materials |
|