N-Ethyl-N-(3-sulfopropyl)aniline sodium salt manufacturers
- ALPS
-
- $39.00
-
2026-07-15
- CAS:82611-85-6
- Purity: 97.49%
- Supply Ability: 10g
|
| | N-Ethyl-N-(3-sulfopropyl)aniline sodium salt Basic information |
| Product Name: | N-Ethyl-N-(3-sulfopropyl)aniline sodium salt | | Synonyms: | N-ETHYL-N-(3-SULFOPROPYL)ANILINE SODIUM SALT;n-ethyl-n-(3-sulfopropyl)aniline;ALPS (N-ETHYL-N-(3-SULFOPROPYL)ANILINE;Sodium 3-(N-Ethylanilino)propanesulfonate;Sodium 3-(N-Ethylanilino)propanesulfonate [for Biochemical Research];N-Ethyl-N-(3-sulfopropyl)aniline sodium salt ,99%;SodiuM 3-(N-Ethylanilino)propanesulfonate ;3-(N-Ethylanilino)propanesulfonic Acid Sodium Salt
N-Ethyl-N-(3-sulfopropyl)aniline Sodium Salt
ALPS | | CAS: | 82611-85-6 | | MF: | C11H16NNaO3S | | MW: | 265.3 | | EINECS: | | | Product Categories: | | | Mol File: | 82611-85-6.mol |  |
| | N-Ethyl-N-(3-sulfopropyl)aniline sodium salt Chemical Properties |
| form | powder to crystal | | color | White to Almost white | | Water Solubility | Soluble | | InChI | InChI=1S/C11H17NO3S.Na/c1-2-12(9-6-10-16(13,14)15)11-7-4-3-5-8-11;/h3-5,7-8H,2,6,9-10H2,1H3,(H,13,14,15);/q;+1/p-1 | | InChIKey | FFJBIXKLISICDT-UHFFFAOYSA-M | | SMILES | C1(=CC=CC=C1)N(CC)CCCS([O-])(=O)=O.[Na+] | | CAS DataBase Reference | 82611-85-6 |
| | N-Ethyl-N-(3-sulfopropyl)aniline sodium salt Usage And Synthesis |
| Chemical Properties | White to light yellow solid | | Uses | ALPS(N-Ethyl-N-sulfopropylaniline sodium salt) is a bio-chemical reagents/chromogenic reagent.
Appearance: White or slightly grayish-yellow powder
Molar absorptivity: ≥9,500 (around 255 nm)
Application: Hydrogen peroxide detection, colorimetric |
| | N-Ethyl-N-(3-sulfopropyl)aniline sodium salt Preparation Products And Raw materials |
|