| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,1,3,3,5,5-Hexamethyltrisiloxane Basic information |
| Product Name: | 1,1,3,3,5,5-Hexamethyltrisiloxane | | Synonyms: | HEXAMETHYLTRISILOXANE;1,1,3,3,5,5-hexamethyl-trisiloxan;1,1,3,3,5,5-Hexametylcyclotrisilazane;1,3,3,5,5-hexamethyltrisiloxane;1,1,3,3,5,5-Hexamethylpentanetrisiloxane;Bis(dimethylsiloxy)dimethylsilane;Dimethylsilylenebis(oxy)bis(dimethylsilane);1,1,3,3,5,5-Hexamethyltrisiloxane,97% | | CAS: | 1189-93-1 | | MF: | C6H20O2Si3 | | MW: | 208.48 | | EINECS: | 214-716-8 | | Product Categories: | Organometallic Reagents;Organosilicon;Siloxanes | | Mol File: | 1189-93-1.mol |  |
| | 1,1,3,3,5,5-Hexamethyltrisiloxane Chemical Properties |
| Melting point | -67°C | | Boiling point | 128 °C (lit.) | | density | 0.822 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.383(lit.) | | Fp | 59 °F | | storage temp. | Flammables area | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.822 | | Water Solubility | Slightly miscible with water. | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | Sensitive | Moisture Sensitive | | BRN | 1746341 | | InChI | 1S/C6H20O2Si3/c1-9(2)7-11(5,6)8-10(3)4/h9-10H,1-6H3 | | InChIKey | HZBDPZBVINJJET-UHFFFAOYSA-N | | SMILES | [H][Si](C)(C)O[Si](C)(C)O[Si]([H])(C)C | | CAS DataBase Reference | 1189-93-1(CAS DataBase Reference) | | EPA Substance Registry System | Trisiloxane, 1,1,3,3,5,5-hexamethyl- (1189-93-1) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16-23-24/25 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | F | 10 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | 1,1,3,3,5,5-Hexamethyltrisiloxane Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 1,1,3,3,5,5-Hexamethyltrisiloxane is involved in the preparation of 2-bis(3-allyl-4-hydroxyphenyl)hexafluoropropane, which is associated with inorganic siloxane polymer and used as a coating material for the detection of toxic chemical warfare agents. It is also used as a silylating agent and to prepare 1,5-Bis[2-(1,2-epoxycyclohex-4-yl)ethyl]-1,1,3,3,5,5-hexamethyltrisiloxane from 4-vinyl-1-cyclohexene-1,2-epoxide by hydrosilylation. |
| | 1,1,3,3,5,5-Hexamethyltrisiloxane Preparation Products And Raw materials |
|