| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | (3S,6S)-3,6-OCTANEDIOL Basic information |
| Product Name: | (3S,6S)-3,6-OCTANEDIOL | | Synonyms: | (3S,6S)-(+)-3,6-OCTANEDIOL;(3S,6S)-3,6-OCTANEDIOL;(3S,6S)-DIHYDROXYOCTANE;(3S,6S)-OCTANE-3,6-DIOL;(3S,6S)-(+)-3,6-Octanediol,99%;(3S,6S)-3,6-OCTANEDIOL, 95%, (98% EE);3,6-Octanediol, (3S,6S)-;(35,65)-3,6-Octancdiol | | CAS: | 136705-66-3 | | MF: | C8H18O2 | | MW: | 146.23 | | EINECS: | | | Product Categories: | organic alcohol;Chiral Compounds;Diols;136705-66-3 | | Mol File: | 136705-66-3.mol |  |
| | (3S,6S)-3,6-OCTANEDIOL Chemical Properties |
| Melting point | 49-51°C | | alpha | +15° (c 10, ethanol) | | Boiling point | 243.79°C (rough estimate) | | density | 0.9636 (rough estimate) | | refractive index | 1.4411 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | crystal | | pka | 14.86±0.20(Predicted) | | color | colorless | | InChI | InChI=1S/C8H18O2/c1-3-7(9)5-6-8(10)4-2/h7-10H,3-6H2,1-2H3/t7-,8-/m0/s1 | | InChIKey | BCKOQWWRTRBSGR-YUMQZZPRSA-N | | SMILES | CC[C@H](O)CC[C@@H](O)CC | | CAS DataBase Reference | 136705-66-3 |
| Provider | Language |
|
ACROS
| English |
| | (3S,6S)-3,6-OCTANEDIOL Usage And Synthesis |
| Chemical Properties | white needle-like crystals |
| | (3S,6S)-3,6-OCTANEDIOL Preparation Products And Raw materials |
|