|
|
| | (S)-1-Boc-piperidine-2-carboxylic acid Basic information |
| | (S)-1-Boc-piperidine-2-carboxylic acid Chemical Properties |
| Melting point | 122-126 °C(lit.) | | alpha | -63.2 º (c=1 in acetic acid) | | Boiling point | 353.2±35.0 °C(Predicted) | | density | 1.164±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform, Methanol | | form | Powder | | pka | 4.03±0.20(Predicted) | | color | White to off-white | | Optical Rotation | [α]23/D 63.2°, c = 1 in acetic acid | | Water Solubility | Insoluble in water. | | BRN | 3652038 | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)12-7-5-4-6-8(12)9(13)14/h8H,4-7H2,1-3H3,(H,13,14)/t8-/m0/s1 | | InChIKey | JQAOHGMPAAWWQO-QMMMGPOBSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCCC[C@H]1C(O)=O | | CAS DataBase Reference | 26250-84-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-36/37/39-22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-1-Boc-piperidine-2-carboxylic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (S)-1-Boc-piperidine-2-carboxylic acid is an N-substituted derivative of Pipecolinic acid useful in modulating ion channel activity. | | Uses | N-Boc-L-pipecolinic acid is a useful boc protected Pipecolic Acid for proteomics research in modulating ion channel activity. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (S)-1-Boc-piperidine-2-carboxylic acid Preparation Products And Raw materials |
|