- Cbz-Gly-OH
-
-
2026-09-11
- CAS:1138-80-3
- Min. Order: 1kg
- Purity: 98+
- Supply Ability: 1T+
- Cbz-Gly-OH
-
-
2026-09-11
- CAS:1138-80-3
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
|
| | N-Carbobenzyloxyglycine Basic information |
| | N-Carbobenzyloxyglycine Chemical Properties |
| Melting point | 118-122 °C(lit.) | | Boiling point | 348.55°C (rough estimate) | | density | 1.2944 (rough estimate) | | refractive index | 1.5400 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | methanol: 0.1 g/mL, clear | | form | Fine Crystalline Powder | | pka | 3.98±0.10(Predicted) | | color | White | | Water Solubility | Soluble in methanol. Insoluble in water. | | BRN | 526877 | | Major Application | peptide synthesis | | InChI | InChI=1S/C10H11NO4/c12-9(13)6-11-10(14)15-7-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,14)(H,12,13) | | InChIKey | CJUMAFVKTCBCJK-UHFFFAOYSA-N | | SMILES | C(O)(=O)CNC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 1138-80-3(CAS DataBase Reference) | | EPA Substance Registry System | Glycine, N-[(phenylmethoxy)carbonyl]- (1138-80-3) |
| Hazard Codes | Xn | | Risk Statements | 62-36/37/38-20/21/22 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | RTECS | MB9129000 | | TSCA | TSCA listed | | HS Code | 29242995 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,intravaginal,380mg/kg (380mg/kg),Journal of Pharmaceutical Sciences. Vol. 68, Pg. 696, 1979. |
| | N-Carbobenzyloxyglycine Usage And Synthesis |
| Chemical Properties | N-Carbobenzyloxyglycine is white to light yellow crystal powde | | Uses | N-Carbobenzoxyglycine is used in the dipeptide synthesis. | | Definition | N-Carbobenzyloxyglycine is a derivative of glycine having a benzyloxycarbonyl protecting group attached to the nitrogen. | | reaction suitability | reaction type: solution phase peptide synthesis | | Safety Profile | and dyspnea. A severe eye and moderate |
| | N-Carbobenzyloxyglycine Preparation Products And Raw materials |
|