| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,3-Dichloro-4,6-dinitrobenzene Basic information |
| Product Name: | 1,3-Dichloro-4,6-dinitrobenzene | | Synonyms: | 1,3-DICHLORO-4,6-DINITROBENZENE;LABOTEST-BB LT00848199;1,5-dichloro-2,4-dinitro-benzen;1,5-dinitro-2,4-dichlorobenzene;2,4-Dichloro-1,5-dinitrobenzene;Benzene, 1,3-dichloro-4,6-dinitro-;Benzene, 1,5-dichloro-2,4-dinitro-;4,6-DICHLORO-1,3-DINITROBENZENE | | CAS: | 3698-83-7 | | MF: | C6H2Cl2N2O4 | | MW: | 237 | | EINECS: | 223-027-1 | | Product Categories: | Building Blocks;Chemical Synthesis;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;Aromatic Hydrocarbons (substituted) & Derivatives;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 3698-83-7.mol |  |
| | 1,3-Dichloro-4,6-dinitrobenzene Chemical Properties |
| Melting point | 101-104 °C(lit.) | | Boiling point | 337.6±37.0 °C(Predicted) | | density | 1.729±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | Light orange to Yellow to Green | | Water Solubility | Insoluble in water. | | BRN | 1685438 | | InChI | 1S/C6H2Cl2N2O4/c7-3-1-4(8)6(10(13)14)2-5(3)9(11)12/h1-2H | | InChIKey | ZPXDNSYFDIHPOJ-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(c(Cl)cc1Cl)[N+]([O-])=O | | CAS DataBase Reference | 3698-83-7(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3-Dichloro-4,6-dinitrobenzene(3698-83-7) | | EPA Substance Registry System | Benzene, 1,5-dichloro-2,4-dinitro- (3698-83-7) |
| Hazard Codes | N,Xi | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | 1,3-Dichloro-4,6-dinitrobenzene Usage And Synthesis |
| Uses | 1,5-Dichloro-2,4-dinitrobenzene is used as pharmaceutical intermediate. |
| | 1,3-Dichloro-4,6-dinitrobenzene Preparation Products And Raw materials |
|