HYDROXYGUANIDINE SULFATE manufacturers
|
| | HYDROXYGUANIDINE SULFATE Basic information |
| | HYDROXYGUANIDINE SULFATE Chemical Properties |
| Melting point | 132-134°C dec. | | storage temp. | 2-8°C | | solubility | Water (Slightly) | | form | Crystals | | color | White | | biological source | synthetic (organic) | | Water Solubility | water: 25mg/mL, clear, colorless | | Stability: | Hygroscopic | | InChI | 1S/2CH5N3O.H2O4S/c2*2-1(3)4-5;1-5(2,3)4/h2*5H,(H4,2,3,4);(H2,1,2,3,4) | | InChIKey | MTGDDPZRXSDPFH-UHFFFAOYSA-N | | SMILES | NC(=N)NO.NC(=N)NO.OS(O)(=O)=O | | CAS DataBase Reference | 6345-29-5 | | EPA Substance Registry System | Guanidine, hydroxy-, sulfate (2:1) (salt) (6345-29-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-27 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | HYDROXYGUANIDINE SULFATE Usage And Synthesis |
| Chemical Properties | Large White Crystals | | Uses | Reacts with NO forming anadduct which is a potent and stable vasodilator. Its actions are very similar to those of NG-Hydroxy-L-arginine on the potentiation and stabilization of NO | | Uses | Reacts with nitric oxide forming an adduct which is a potent and stable vasodilator | | Biological Activity | An early antitumor agent. Oxidation results in release of NO, and formation of other reactive oxygen species, including peroxynitrite and peroxyl radicals. Reacts with NO to form an adduct which is a potent and stable vasodilator. |
| | HYDROXYGUANIDINE SULFATE Preparation Products And Raw materials |
|