4'-Methoxybutyrophenone manufacturers
- 4"-Methoxybutyrophenone
-
- $15.00 / 1KG
-
2021-08-12
- CAS:4160-51-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4'-Methoxybutyrophenone Basic information |
| Product Name: | 4'-Methoxybutyrophenone | | Synonyms: | 4'-METHOXYBUTYROPHENONE, TECH., 93%;4-Methoxyphenylpropyl ketone;4'-Methoxybutyrophenone,93%,tech.;4-METHOXYBUTYROPHENONE;1-(4-METHOXYPHENYL)-1-BUTANONE;1-(4-METHOXYPHENYL)BUTAN-1-ONE;P-BUTYRYLANISOLE;P-METHOXYPHENYL-PROPYLKETONE | | CAS: | 4160-51-4 | | MF: | C11H14O2 | | MW: | 178.23 | | EINECS: | 223-995-5 | | Product Categories: | Miscellaneous | | Mol File: | 4160-51-4.mol |  |
| | 4'-Methoxybutyrophenone Chemical Properties |
| Melting point | 22 °C | | Boiling point | 124-128 °C (4 mmHg) | | density | 1.0292 (rough estimate) | | refractive index | 1.5378-1.5398 | | Fp | 124-128°C/4mm | | storage temp. | Store at room temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | BRN | 908286 | | InChI | InChI=1S/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 | | InChIKey | JLCDSZXBELPBRD-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(OC)C=C1)(=O)CCC | | CAS DataBase Reference | 4160-51-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1-(4-Methoxyphenyl)-1-butanone(4160-51-4) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | HazardClass | IRRITANT | | HS Code | 2914409000 |
| | 4'-Methoxybutyrophenone Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW LIQUID |
| | 4'-Methoxybutyrophenone Preparation Products And Raw materials |
|