| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-(Trifluoroacetyl)benzoic acid Basic information |
| Product Name: | 4-(Trifluoroacetyl)benzoic acid | | Synonyms: | LABOTEST-BB LT00454127;1-(4-Carboxyphenyl)-2,2,2-trifluoroethan-1-one, 4'-Carboxy-2,2,2-trifluoroacetophenone;4-Carboxy-alpha,alpha,alpha-trifluoroacetophenone;Benzoic acid, 4-(trifluoroacetyl)- (9CI);4-(Trifluoroacetyl)Benzoicacid97+%;4-carboxy-à,à,à-trifluoroacetophenone;p-(Trifluoroacetyl)benzoic acid;4-(Trifluoroacetyl)benzoic acid >=97.0% (HPLC) | | CAS: | 58808-59-6 | | MF: | C9H5F3O3 | | MW: | 218.13 | | EINECS: | | | Product Categories: | ACETYLHALIDE | | Mol File: | 58808-59-6.mol |  |
| | 4-(Trifluoroacetyl)benzoic acid Chemical Properties |
| Melting point | 178 °C | | Boiling point | 313.5±42.0 °C(Predicted) | | density | 1.455±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | pka | 3.40±0.10(Predicted) | | color | White | | Sensitive | Hygroscopic | | BRN | 2728778 | | InChI | 1S/C9H5F3O3/c10-9(11,12)7(13)5-1-3-6(4-2-5)8(14)15/h1-4H,(H,14,15) | | InChIKey | WLTZCRCZDLLXQP-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(cc1)C(=O)C(F)(F)F | | CAS DataBase Reference | 58808-59-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 4-(Trifluoroacetyl)benzoic acid Usage And Synthesis |
| | 4-(Trifluoroacetyl)benzoic acid Preparation Products And Raw materials |
|