2'-FLUOROACETOPHENONE manufacturers
- 2-FLUOROACETOPHENONE
-
- $25.00 / 1KG
-
2025-12-12
- CAS:450-95-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200000KG
- 2-Fluoroacetophenone
-
- $0.00 / 1KG
-
2022-02-22
- CAS:450-95-3
- Min. Order: 1KG
- Purity: 98.7%
- Supply Ability: 100 tons
- 2'-FLUOROACETOPHENONE
-
- $1.00 / 1ASSAYS
-
2020-01-09
- CAS:450-95-3
- Min. Order: 1ASSAYS
- Purity: 85.0-99.8%
- Supply Ability: 20tons
|
| | 2'-FLUOROACETOPHENONE Basic information |
| Product Name: | 2'-FLUOROACETOPHENONE | | Synonyms: | O-FLUOROACETOPHENONE;LABOTEST-BB LT01148268;1-Phenyl-2-fluoroethanone;α-Fluoroacetophenone;2-fluoro-1-phenylethanone;2-fluoro-1-phenyl-ethanone;2-Fluoroacetophenone, 2-Fluoro-1-phenylethan-1-one;omega-Fluoroacetophenone | | CAS: | 450-95-3 | | MF: | C8H7FO | | MW: | 138.14 | | EINECS: | 207-190-6 | | Product Categories: | ACETYLHALIDE | | Mol File: | 450-95-3.mol |  |
| | 2'-FLUOROACETOPHENONE Chemical Properties |
| Melting point | 26-27 | | Boiling point | 187-189 °C(lit.) | | density | 1.137 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.507(lit.) | | Fp | 143 °F | | storage temp. | Storage temp. 2-8°C | | form | fused solid | | color | Off-white | | InChI | InChI=1S/C8H7FO/c9-6-8(10)7-4-2-1-3-5-7/h1-5H,6H2 | | InChIKey | YOMBUJAFGMOIGS-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=CC=C1)CF | | CAS DataBase Reference | 450-95-3(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29147000 |
| | 2'-FLUOROACETOPHENONE Usage And Synthesis |
| Uses | 2-Fluoroacetophenone is used in method for synthesizing -Fluorinated Ketone by hydrazonation of fatty chain monoketone. | | Synthesis Reference(s) | Journal of the American Chemical Society, 76, p. 4137, 1954 DOI: 10.1021/ja01645a025
Tetrahedron Letters, 28, p. 4733, 1987 DOI: 10.1016/S0040-4039(00)96612-7 |
| | 2'-FLUOROACETOPHENONE Preparation Products And Raw materials |
|