|
|
| | trans-4-tert-Butylcyclohexanecarboxylic acid Basic information |
| | trans-4-tert-Butylcyclohexanecarboxylic acid Chemical Properties |
| Melting point | 170-175 °C | | Boiling point | 282.9±8.0 °C(Predicted) | | density | 0.996±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.92±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C11H20O2/c1-11(2,3)9-6-4-8(5-7-9)10(12)13/h8-9H,4-7H2,1-3H3,(H,12,13)/t8-,9- | | InChIKey | QVQKEGYITJBHRQ-KYZUINATSA-N | | SMILES | [C@@H]1(C(O)=O)CC[C@@H](C(C)(C)C)CC1 | | CAS DataBase Reference | 943-29-3 | | NIST Chemistry Reference | Cyclohexanecarboxylic acid, 4-(1,1-dimethylethyl)-, trans-(943-29-3) |
| Provider | Language |
|
ACROS
| English |
| | trans-4-tert-Butylcyclohexanecarboxylic acid Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Definition | ChEBI: Trans-4-tert-butylcyclohexanecarboxylic acid is a monocarboxylic acid that is cyclohexanecarboxylic acid substituted by a tert-butyl group at position 4 (the trans-stereoisomer). It has a role as a metabolite. It derives from a hydride of a cyclohexane. |
| | trans-4-tert-Butylcyclohexanecarboxylic acid Preparation Products And Raw materials |
|