|
|
| | 2,3-Dibromofuran-5-carboxylic acid Basic information |
| Product Name: | 2,3-Dibromofuran-5-carboxylic acid | | Synonyms: | 4,5-DIBROMO-2-FUROIC ACID;2,3-DIBROMOFURAN-5-CARBOXYLIC ACID;4,5-Dibromo-2-furancarboxylic acid;4,5-Dibromo-2-furoicacid,97%;4,5-dibromofuran-2-carboxylic acid;4,5-DibroMo-2-furoic acid 97%;2-Furancarboxylic acid, 4,5-dibromo- | | CAS: | 2434-03-9 | | MF: | C5H2Br2O3 | | MW: | 269.88 | | EINECS: | | | Product Categories: | Building Blocks;C4 to C7;C4 to C8;Chemical Synthesis;Furans;Halogenated Heterocycles;Heterocyclic Building Blocks;Heterocycles | | Mol File: | 2434-03-9.mol |  |
| | 2,3-Dibromofuran-5-carboxylic acid Chemical Properties |
| Melting point | 169-173 °C | | Boiling point | 328.7±42.0 °C(Predicted) | | density | 2.304±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 2.58±0.16(Predicted) | | Appearance | White to off-white Solid | | BRN | 129312 | | InChI | InChI=1S/C5H2Br2O3/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) | | InChIKey | BHUVICYZDBUMIU-UHFFFAOYSA-N | | SMILES | O1C(Br)=C(Br)C=C1C(O)=O | | CAS DataBase Reference | 2434-03-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2932190090 |
| | 2,3-Dibromofuran-5-carboxylic acid Usage And Synthesis |
| Uses | 2,3-Dibromofuran-5-carboxylic acid is used in a study of the effect of a furanyl halo-substituent on the intramolecular Diels-Alder reaction between the furan ring system and a pendant allylamide. The yield of the cycloaddition is improved with a C-5 bromide vs -chloro or -unsubstituted furan. | | Synthesis | Step B: Synthesis of 4,5-dibromo-2-furoic acid. Methyl 4,5-dibromofuran-2-carboxylate (26.19 g, 92.2 mmol) was suspended in THF (60 mL) followed by addition of LiOH (3 M aqueous solution, 60 mL, 180 mmol). The resulting two-phase mixture was stirred at room temperature for 4 hours. Upon completion of the reaction, the mixture was slowly poured into 1 N HCl solution and extracted with dichloromethane (DCM, 4 x 60 mL). The organic phases were combined, dried over anhydrous sodium sulfate and concentrated under reduced pressure to give 24.59 g (99% yield) of the target product 4,5-dibromo-2-furoic acid as an off-white solid. The product was characterized by 1H NMR (CD3OD): δ 7.30 (s, 1H). | | References | [1] Patent: WO2008/124518, 2008, A1. Location in patent: Page/Page column 18
[2] Patent: US2006/69286, 2006, A1. Location in patent: Page/Page column 25
[3] Chemical and Pharmaceutical Bulletin, 1997, vol. 45, # 5, p. 799 - 806
[4] European Journal of Organic Chemistry, 1999, # 9, p. 2045 - 2057 |
| | 2,3-Dibromofuran-5-carboxylic acid Preparation Products And Raw materials |
|