|
|
| | METHYL 3-(TRIMETHYLSILYL)-4-PENTENOATE Basic information |
| Product Name: | METHYL 3-(TRIMETHYLSILYL)-4-PENTENOATE | | Synonyms: | METHYL 3-(TRIMETHYLSILYL)-4-PENTENOATE;3-(Trimethylsilyl)-4-pentenoic acid methyl ester;Methyl 3-(triMethylsilyl)pent-4-enoate;4-Pentenoic acid,3-(triMethylsilyl)-, Methyl ester;Eribulin Impurity 1;3- (trimethylmethilyl) -4-prenenlate;Methyl 3-(trimethylsilyl)-4-pentenoate;Azerbrin Impurity 1 | | CAS: | 185411-12-5 | | MF: | C9H18O2Si | | MW: | 186.32 | | EINECS: | 1592732-453-0 | | Product Categories: | C8 to C9;Carbonyl Compounds;Esters | | Mol File: | 185411-12-5.mol |  |
| | METHYL 3-(TRIMETHYLSILYL)-4-PENTENOATE Chemical Properties |
| Boiling point | 54 °C5.5 mm Hg(lit.) | | density | 0.899 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.443(lit.) | | Fp | 149 °F | | storage temp. | 2-8°C | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C9H18O2Si/c1-6-8(12(3,4)5)7-9(10)11-2/h6,8H,1,7H2,2-5H3 | | InChIKey | DJXDHDYQDMVTPZ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CC([Si](C)(C)C)C=C |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids |
| | METHYL 3-(TRIMETHYLSILYL)-4-PENTENOATE Usage And Synthesis |
| Uses | Methyl 3-(trimethylsilyl)-4-pentenoate, can be used in the synthesis of Eribulin (E615203), a synthetic analog of the marine natural product halichondrin B. |
| | METHYL 3-(TRIMETHYLSILYL)-4-PENTENOATE Preparation Products And Raw materials |
|