- TRIMETHYLSILANE
-
- $9.80
-
2020-01-10
- CAS:993-07-7
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | TRIMETHYLSILANE Basic information |
| Product Name: | TRIMETHYLSILANE | | Synonyms: | Trimethylsilane,97%;TRIMETHYLSILANE (IN CYLINDER);trimethylsilicon;Trimethylsilyl hydride, 2-Methyl-2-silapropane;Trimethylsilane 99.9%;SILICON TRIMETHYL;TRIMETHYLSILANE;(CH3)3SiH | | CAS: | 993-07-7 | | MF: | C3H10Si | | MW: | 74.2 | | EINECS: | 213-603-0 | | Product Categories: | organosilicon compounds;TOP3 | | Mol File: | 993-07-7.mol |  |
| | TRIMETHYLSILANE Chemical Properties |
| Melting point | -135,9°C | | Boiling point | 6,7°C | | density | 0,638 g/cm3 | | refractive index | 1.3800 (estimate) | | Fp | <-29°C | | form | liquid | | Specific Gravity | 0.638 | | Water Solubility | 1.4g/L at 20℃ | | Specific Heat Capacity | Cp(gas): 1.59 J/(g·K), at 25℃ | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | InChI | InChI=1S/C3H10Si/c1-4(2)3/h4H,1-3H3 | | InChIKey | PQDJYEQOELDLCP-UHFFFAOYSA-N | | SMILES | [SiH](C)(C)C | | LogP | 2.2 at 20℃ | | CAS DataBase Reference | 993-07-7 | | EPA Substance Registry System | Silane, trimethyl- (993-07-7) |
| | TRIMETHYLSILANE Usage And Synthesis |
| Chemical Properties | Trimethylsilane is a colorless liquid with a pungent odor and heavier-than-air vapors that may travel along the ground and cause distant fires. | | Uses | Potential reducing agent that will produce low boiling
hexamethyldisiloxane by-product. | | Flammability and Explosibility | Extremely flammable liquified gas | | Toxics Screening Level | The Initial Threshold Screening Level (ITSL) is 340 μg/m3 annual average. |
| | TRIMETHYLSILANE Preparation Products And Raw materials |
|