|
|
| | (2,4-Dichlorobenzyl)methylamine Basic information |
| | (2,4-Dichlorobenzyl)methylamine Chemical Properties |
| Boiling point | 123°C/13mmHg(lit.) | | density | 1.226±0.06 g/cm3(Predicted) | | refractive index | 1.5560 to 1.5600 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Low Melting Solid | | pka | 8.44±0.10(Predicted) | | color | Colorless | | InChI | InChI=1S/C8H9Cl2N/c1-11-5-6-2-3-7(9)4-8(6)10/h2-4,11H,5H2,1H3 | | InChIKey | GUJXWKXDISDARD-UHFFFAOYSA-N | | SMILES | C1(CNC)=CC=C(Cl)C=C1Cl | | CAS DataBase Reference | 5013-77-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41 | | Safety Statements | 26-36/37/39-39 | | RIDADR | UN 2735 8/PG III | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2921490090 |
| | (2,4-Dichlorobenzyl)methylamine Usage And Synthesis |
| Uses | (2,4-Dichlorobenzyl)methylamine is a precursor used in the synthesis of 1-benzyloxypyrazin-2(1H)-one derivatives. |
| | (2,4-Dichlorobenzyl)methylamine Preparation Products And Raw materials |
|