| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- α-Sexithiophene
-
- $1.00
-
2026-02-02
- CAS:88493-55-4
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 50tons
|
| | alpha-Sexithiophene Basic information |
| | alpha-Sexithiophene Chemical Properties |
| Melting point | 290 °C (dec.)(lit.) | | Boiling point | 608.5±50.0 °C(Predicted) | | density | 1.402 | | form | solid | | color | Light yellow to Brown | | semiconductor properties | P-type (mobility=0.075cm2/V·s) | | InChI | 1S/C24H14S6/c1-3-15(25-13-1)17-5-7-19(27-17)21-9-11-23(29-21)24-12-10-22(30-24)20-8-6-18(28-20)16-4-2-14-26-16/h1-14H | | InChIKey | KUJYDIFFRDAYDH-UHFFFAOYSA-N | | SMILES | c1csc(c1)-c2ccc(s2)-c3ccc(s3)-c4ccc(s4)-c5ccc(s5)-c6cccs6 | | CAS DataBase Reference | 88493-55-4 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | alpha-Sexithiophene Usage And Synthesis |
| Uses | Sexithiophene is an organic semiconductor/transistor. |
| | alpha-Sexithiophene Preparation Products And Raw materials |
| Raw materials | 2,2'-Bithiophene, 5-iodo--->Magnesium, [2,2'-bithiophen]-5-ylbromo--->2,2':5',2''-Terthiophene, 5,5''-diiodo--->2-Bromoterthiophene-->5,5'-Dibromo-2,2'-bithiophene-->5,5'-Diiodo-2,2'-bithiophene-->2,2':5',2''-Terthiophene-->2,2'-Bithiophene-->2-Iodothiophene | | Preparation Products | o-Quarterphenyl |
|