- Ibuprofen Impurity
-
-
2025-12-16
- CAS:65813-55-0
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 100000
|
| | 1-Oxo Ibuprofen Basic information |
| | 1-Oxo Ibuprofen Chemical Properties |
| Melting point | 85-87°C | | Boiling point | 378.0±17.0 °C(Predicted) | | density | 1.106±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.08±0.10(Predicted) | | color | White to Off-White | | BRN | 2844898 | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C13H16O3/c1-8(2)12(14)11-6-4-10(5-7-11)9(3)13(15)16/h4-9H,1-3H3,(H,15,16) | | InChIKey | RCINGEKPKJQCMO-UHFFFAOYSA-N | | SMILES | OC(C(C)C1=CC=C(C(C(C)C)=O)C=C1)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2917394000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-Oxo Ibuprofen Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 1-Oxo Ibuprofen, is a degradation product of Ibuprofen arising from oxidative and thermal treatments. 1-Oxo Ibuprofen is the Ibuprofen impurity J. | | Uses | 1-Oxo Ibuprofen (Ibuprofen EP Impurity J), is a degradation product of Ibuprofen arising from oxidative and thermal treatments. 1-Oxo Ibuprofen is the Ibuprofen impurity J. | | Uses | Degradation product of Ibuprofen arising from oxidative and thermal treatments. Ibuprofen impurity J |
| | 1-Oxo Ibuprofen Preparation Products And Raw materials |
|