|
|
| | (2RS)-2-(4-FORMYLPHENYL)PROPANOIC ACID Basic information |
| | (2RS)-2-(4-FORMYLPHENYL)PROPANOIC ACID Chemical Properties |
| Melting point | >75°C | | Boiling point | 352.3±17.0 °C(Predicted) | | density | 1.222±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.11±0.10(Predicted) | | color | White to Pale Yellow | | Major Application | clinical testing | | InChI | 1S/C10H10O3/c1-7(10(12)13)9-4-2-8(6-11)3-5-9/h2-7H,1H3,(H,12,13) | | InChIKey | IAXYHYOWEQQFMC-UHFFFAOYSA-N | | SMILES | OC(C(C)C1=CC=C(C([H])=O)C=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (2RS)-2-(4-FORMYLPHENYL)PROPANOIC ACID Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | rac 2-(4-Formylphenyl)propionic Acid (Ibuprofen EP Impurity K) is a degradation product of Ibuprofen arising from oxidative and thermal treatments. Ibuprofen impurity K. |
| | (2RS)-2-(4-FORMYLPHENYL)PROPANOIC ACID Preparation Products And Raw materials |
|