- Ethyl 3,3-dimethylacrylate
-
- $15.00 / 1KG
-
2021-08-12
- CAS:638-10-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Ethyl 3,3-dimethylacrylate Basic information |
| | Ethyl 3,3-dimethylacrylate Chemical Properties |
| Melting point | -62.68°C (estimate) | | Boiling point | 154-155 °C (lit.) | | density | 0.922 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.436(lit.) | | Fp | 93 °F | | storage temp. | Store at room temperature | | Water Solubility | Insoluble in water | | form | clear liquid | | color | Colorless to Almost colorless | | Stability: | Stable. Flammable. Incompatible with acids, bases, oxidizing agents, reducing agents. | | InChI | InChI=1S/C7H12O2/c1-4-9-7(8)5-6(2)3/h5H,4H2,1-3H3 | | InChIKey | UTXVCHVLDOLVPC-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)/C=C(/C)\C | | LogP | 2.225 (est) | | CAS DataBase Reference | 638-10-8(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Butenoic acid, 3-methyl-, ethyl ester(638-10-8) | | EPA Substance Registry System | 2-Butenoic acid, 3-methyl-, ethyl ester (638-10-8) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-29-33-28-26 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 2 | | RTECS | GQ5750000 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29161900 |
| | Ethyl 3,3-dimethylacrylate Usage And Synthesis |
| Chemical Properties | liquid | | Uses | Ethyl 3,3-dimethylacrylate was used in the synthesis of:
- 3-benzylmercupto-3-methylbutanoic acid ethylester
- cis-2-cyano-3,3-dimethylcyclopropanecarboxylic acid, precursor for the synthesis of cis-pyrethroids
- 1-[13CD3]-9-cis-retinoic acid
| | General Description | Ion-molecule reactions between the O=P(OCH3)2+phosphonium ions and ethyl 3,3-dimethylacrylate has been investigated by quadrupole ion trap mass spectrometery. |
| | Ethyl 3,3-dimethylacrylate Preparation Products And Raw materials |
| Preparation Products | 4,6-Dimethyl-2-pyrone-->Glycine, N-[(1,1-dimethylethoxy)carbonyl]-, 3-methyl-2-buten-1-yl ester-->Succinic acid, 3-cyano-2,2-dimethyl-, diethyl ester (6CI)-->Ethyl 1-benzyl-4,4-diMethylpyrrolidine-3-carboxylate-->Ethyl 2,3 - dibroMo - 3 - Methylbutanoate-->6-FLUORO-3,3-DIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE |
|